C14H22O2 — CID 132571018
(9E)-6,10-dimethyldodeca-9,11-diene-2,4-dione (PubChem CID 132571018) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (9E)-6,10-dimethyldodeca-9,11-diene-2,4-dione.
| Compound Name | (9E)-6,10-dimethyldodeca-9,11-diene-2,4-dione |
|---|---|
| PubChem CID | 132571018 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (9E)-6,10-dimethyldodeca-9,11-diene-2,4-dione |
| SMILES | C=C/C(C)=C/CCC(C)CC(=O)CC(C)=O |
| InChI | InChI=1S/C14H22O2/c1-5-11(2)7-6-8-12(3)9-14(16)10-13(4)15/h5,7,12H,1,6,8-10H2,2-4H3/b11-7+ |
| InChIKey | UCMWTPQGNIJMEN-YRNVUSSQSA-N |
| XLogP | 3.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|