C15H20O3 — CID 23425133
5-[(5Z)-2,6-dimethylocta-5,7-dienyl]furan-3-carboxylic acid (PubChem CID 23425133) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 5-[(5Z)-2,6-dimethylocta-5,7-dienyl]furan-3-carboxylic acid.
| Compound Name | 5-[(5Z)-2,6-dimethylocta-5,7-dienyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 23425133 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-[(5Z)-2,6-dimethylocta-5,7-dienyl]furan-3-carboxylic acid |
| SMILES | C=C/C(C)=C\CCC(C)Cc1cc(C(=O)O)co1 |
| InChI | InChI=1S/C15H20O3/c1-4-11(2)6-5-7-12(3)8-14-9-13(10-18-14)15(16)17/h4,6,9-10,12H,1,5,7-8H2,2-3H3,(H,16,17)/b11-6- |
| InChIKey | OBTTZAFAGQEVHZ-WDZFZDKYSA-N |
| XLogP | 4.07 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|