C17H24O3 — CID 163031457
ethyl 5-[(2S)-2,6-dimethylocta-5,7-dienyl]furan-3-carboxylate (PubChem CID 163031457) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl 5-[(2S)-2,6-dimethylocta-5,7-dienyl]furan-3-carboxylate.
| Compound Name | ethyl 5-[(2S)-2,6-dimethylocta-5,7-dienyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 163031457 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | ethyl 5-[(2S)-2,6-dimethylocta-5,7-dienyl]furan-3-carboxylate |
| SMILES | C=CC(C)=CCC[C@H](C)Cc1cc(C(=O)OCC)co1 |
| InChI | InChI=1S/C17H24O3/c1-5-13(3)8-7-9-14(4)10-16-11-15(12-20-16)17(18)19-6-2/h5,8,11-12,14H,1,6-7,9-10H2,2-4H3/t14-/m0/s1 |
| InChIKey | CSOBPKZBMLCLBA-AWEZNQCLSA-N |
| XLogP | 4.55 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|