methyl 5-ethylfuran-3-carboxylate

C8H10O3 — CID 23661323

IUPACmethyl 5-ethylfuran-3-carboxylate
SMILESCCc1cc(C(=O)OC)co1
InChIInChI=1S/C8H10O3/c1-3-7-4-6(5-11-7)8(9)10-2/h4-5H,3H2,1-2H3
InChIKeyCESKFUQJWPNEIK-UHFFFAOYSA-N
MW154.16 g/mol
LogP1.63
Rot. Bonds2

About methyl 5-ethylfuran-3-carboxylate

methyl 5-ethylfuran-3-carboxylate (PubChem CID 23661323) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is methyl 5-ethylfuran-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-ethylfuran-3-carboxylate
PubChem CID23661323
Molecular FormulaC8H10O3
Molecular Weight154.16 g/mol
Exact Mass154.06
IUPAC Namemethyl 5-ethylfuran-3-carboxylate
SMILESCCc1cc(C(=O)OC)co1
InChIInChI=1S/C8H10O3/c1-3-7-4-6(5-11-7)8(9)10-2/h4-5H,3H2,1-2H3
InChIKeyCESKFUQJWPNEIK-UHFFFAOYSA-N
XLogP1.63
TPSA39.44 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.16
LogP ≤ 51.63
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-ethylfuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-ethylfuran-3-carboxylate?
The IUPAC name of methyl 5-ethylfuran-3-carboxylate (CID 23661323) is methyl 5-ethylfuran-3-carboxylate.
What is the SMILES notation for methyl 5-ethylfuran-3-carboxylate?
The canonical SMILES for methyl 5-ethylfuran-3-carboxylate is CCc1cc(C(=O)OC)co1.
What is the InChIKey of methyl 5-ethylfuran-3-carboxylate?
The InChIKey is CESKFUQJWPNEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-3-7-4-6(5-11-7)8(9)10-2/h4-5H,3H2,1-2H3.
What are the key properties of methyl 5-ethylfuran-3-carboxylate?
methyl 5-ethylfuran-3-carboxylate has a molecular weight of 154.16 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethylfuran-3-carboxylate is sourced from PubChem (CID 23661323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).