C12H19NO3S — CID 104586610
methyl 5-[(1-methylsulfanylbutan-2-ylamino)methyl]furan-3-carboxylate (PubChem CID 104586610) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is methyl 5-[(1-methylsulfanylbutan-2-ylamino)methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(1-methylsulfanylbutan-2-ylamino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104586610 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | methyl 5-[(1-methylsulfanylbutan-2-ylamino)methyl]furan-3-carboxylate |
| SMILES | CCC(CSC)NCc1cc(C(=O)OC)co1 |
| InChI | InChI=1S/C12H19NO3S/c1-4-10(8-17-3)13-6-11-5-9(7-16-11)12(14)15-2/h5,7,10,13H,4,6,8H2,1-3H3 |
| InChIKey | FLJAWCNABLVUMH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |