C16H19NO4 — CID 104609167
methyl 5-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]furan-3-carboxylate (PubChem CID 104609167) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 5-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104609167 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 5-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CN[C@H](C)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C16H19NO4/c1-11(12-5-4-6-14(7-12)19-2)17-9-15-8-13(10-21-15)16(18)20-3/h4-8,10-11,17H,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | ZLIQBTHVWCUOTN-LLVKDONJSA-N |
| XLogP | 2.93 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |