C10H14N2O4 — CID 104586651
methyl 5-[[(1-amino-1-oxopropan-2-yl)amino]methyl]furan-3-carboxylate (PubChem CID 104586651) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 5-[[(1-amino-1-oxopropan-2-yl)amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[(1-amino-1-oxopropan-2-yl)amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104586651 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | methyl 5-[[(1-amino-1-oxopropan-2-yl)amino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNC(C)C(N)=O)c1 |
| InChI | InChI=1S/C10H14N2O4/c1-6(9(11)13)12-4-8-3-7(5-16-8)10(14)15-2/h3,5-6,12H,4H2,1-2H3,(H2,11,13) |
| InChIKey | XUFSCEGRJXFXNJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |