C9H10O5 — CID 99988483
3-(4-methoxycarbonylfuran-2-yl)propanoic acid (PubChem CID 99988483) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 3-(4-methoxycarbonylfuran-2-yl)propanoic acid.
| Compound Name | 3-(4-methoxycarbonylfuran-2-yl)propanoic acid |
|---|---|
| PubChem CID | 99988483 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3-(4-methoxycarbonylfuran-2-yl)propanoic acid |
| SMILES | COC(=O)c1coc(CCC(=O)O)c1 |
| InChI | InChI=1S/C9H10O5/c1-13-9(12)6-4-7(14-5-6)2-3-8(10)11/h4-5H,2-3H2,1H3,(H,10,11) |
| InChIKey | KRJDIOZIBCPRBY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |