C12H23NO — CID 91172474
N-ethyl-3,7-dimethyloct-6-enamide (PubChem CID 91172474) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N-ethyl-3,7-dimethyloct-6-enamide.
| Compound Name | N-ethyl-3,7-dimethyloct-6-enamide |
|---|---|
| PubChem CID | 91172474 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-ethyl-3,7-dimethyloct-6-enamide |
| SMILES | CCNC(=O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C12H23NO/c1-5-13-12(14)9-11(4)8-6-7-10(2)3/h7,11H,5-6,8-9H2,1-4H3,(H,13,14) |
| InChIKey | QOEBPQOZGPYFLC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|