C22H37NO3 — CID 21298048
2-[[(6E,10E)-3,7,11,15-tetramethylhexadeca-6,10,14-trienoyl]amino]acetic acid (PubChem CID 21298048) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 2-[[(6E,10E)-3,7,11,15-tetramethylhexadeca-6,10,14-trienoyl]amino]acetic acid.
| Compound Name | 2-[[(6E,10E)-3,7,11,15-tetramethylhexadeca-6,10,14-trienoyl]amino]acetic acid |
|---|---|
| PubChem CID | 21298048 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 2-[[(6E,10E)-3,7,11,15-tetramethylhexadeca-6,10,14-trienoyl]amino]acetic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)CC(=O)NCC(=O)O |
| InChI | InChI=1S/C22H37NO3/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-21(24)23-16-22(25)26/h9,11,13,20H,6-8,10,12,14-16H2,1-5H3,(H,23,24)(H,25,26)/b18-11+,19-13+ |
| InChIKey | KOXOCDDUKXNAHH-NWLVNBMCSA-N |
| XLogP | 5.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|