C17H28O — CID 91460202
(3E)-5,9,13-trimethyltetradeca-3,8,12-trien-2-one (PubChem CID 91460202) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (3E)-5,9,13-trimethyltetradeca-3,8,12-trien-2-one.
| Compound Name | (3E)-5,9,13-trimethyltetradeca-3,8,12-trien-2-one |
|---|---|
| PubChem CID | 91460202 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (3E)-5,9,13-trimethyltetradeca-3,8,12-trien-2-one |
| SMILES | CC(=O)/C=C/C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C17H28O/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-17(5)18/h8,10,12-13,16H,6-7,9,11H2,1-5H3/b13-12+,15-10? |
| InChIKey | KYNWITURMVLLHF-NQKZQFAOSA-N |
| XLogP | 5.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|