C30H50 — CID 162475328
(6E,11E,18E)-2,6,10,19,23-pentamethyl-15-methylidenetetracosa-2,6,11,18,22-pentaene (PubChem CID 162475328) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is (6E,11E,18E)-2,6,10,19,23-pentamethyl-15-methylidenetetracosa-2,6,11,18,22-pentaene.
| Compound Name | (6E,11E,18E)-2,6,10,19,23-pentamethyl-15-methylidenetetracosa-2,6,11,18,22-pentaene |
|---|---|
| PubChem CID | 162475328 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | (6E,11E,18E)-2,6,10,19,23-pentamethyl-15-methylidenetetracosa-2,6,11,18,22-pentaene |
| SMILES | C=C(CC/C=C/C(C)CC/C=C(\C)CCC=C(C)C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h10,15-16,18,23-24,28H,5,9,11-14,17,19-22H2,1-4,6-8H3/b18-10+,29-23+,30-24+ |
| InChIKey | SMJUUAUGOONSSI-CMWMJNCKSA-N |
| XLogP | 10.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|