C29H48O — CID 57278514
22-ethenoxy-2,6,10,15,19-pentamethyldocosa-2,6,11,14,18-pentaene (PubChem CID 57278514) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is 22-ethenoxy-2,6,10,15,19-pentamethyldocosa-2,6,11,14,18-pentaene.
| Compound Name | 22-ethenoxy-2,6,10,15,19-pentamethyldocosa-2,6,11,14,18-pentaene |
|---|---|
| PubChem CID | 57278514 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | 22-ethenoxy-2,6,10,15,19-pentamethyldocosa-2,6,11,14,18-pentaene |
| SMILES | C=COCCCC(C)=CCCC(C)=CCC=CC(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C29H48O/c1-8-30-24-14-23-29(7)22-13-20-27(5)17-10-9-16-26(4)19-12-21-28(6)18-11-15-25(2)3/h8-9,15-17,21-22,26H,1,10-14,18-20,23-24H2,2-7H3 |
| InChIKey | JDYYZECXVLANBL-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|