C20H36 — CID 165013974
3,7-dimethylocta-1,6-diene;(6E)-2,6-dimethylocta-2,6-diene (PubChem CID 165013974) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-diene;(6E)-2,6-dimethylocta-2,6-diene.
| Compound Name | 3,7-dimethylocta-1,6-diene;(6E)-2,6-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 165013974 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 3,7-dimethylocta-1,6-diene;(6E)-2,6-dimethylocta-2,6-diene |
| SMILES | C/C=C(\C)CCC=C(C)C.C=CC(C)CCC=C(C)C |
| InChI | InChI=1S/2C10H18/c2*1-5-10(4)8-6-7-9(2)3/h5,7H,6,8H2,1-4H3;5,7,10H,1,6,8H2,2-4H3/b10-5+; |
| InChIKey | KCZQVWBWPIAZFS-OAZHBLANSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|