C17H32 — CID 143275958
ethane;(6E,10Z)-2,6,10-trimethyldodeca-2,6,10-triene (PubChem CID 143275958) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is ethane;(6E,10Z)-2,6,10-trimethyldodeca-2,6,10-triene.
| Compound Name | ethane;(6E,10Z)-2,6,10-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 143275958 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | ethane;(6E,10Z)-2,6,10-trimethyldodeca-2,6,10-triene |
| SMILES | C/C=C(/C)CC/C=C(\C)CCC=C(C)C.CC |
| InChI | InChI=1S/C15H26.C2H6/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3;1-2/h6,9,12H,7-8,10-11H2,1-5H3;1-2H3/b14-6-,15-12+; |
| InChIKey | OSFJLYCZRHWPKY-LTCREPBCSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|