C20H40 — CID 145317511
ethane;(2E,6E,10E)-3,6,10-trimethyltrideca-2,6,10-triene (PubChem CID 145317511) has the molecular formula C20H40 and a molecular weight of 280.54 g/mol. Its IUPAC name is ethane;(2E,6E,10E)-3,6,10-trimethyltrideca-2,6,10-triene.
| Compound Name | ethane;(2E,6E,10E)-3,6,10-trimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 145317511 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | ethane;(2E,6E,10E)-3,6,10-trimethyltrideca-2,6,10-triene |
| SMILES | C/C=C(\C)CC/C(C)=C/CC/C(C)=C/CC.CC.CC |
| InChI | InChI=1S/C16H28.2C2H6/c1-6-9-15(4)10-8-11-16(5)13-12-14(3)7-2;2*1-2/h7,9,11H,6,8,10,12-13H2,1-5H3;2*1-2H3/b14-7+,15-9+,16-11+;; |
| InChIKey | TURDRUJPTHVGMV-KXMQVHTQSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|