C14H25N — CID 129175719
(5E,9E)-N,5,9-trimethylundeca-5,9-dien-2-imine (PubChem CID 129175719) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (5E,9E)-N,5,9-trimethylundeca-5,9-dien-2-imine.
| Compound Name | (5E,9E)-N,5,9-trimethylundeca-5,9-dien-2-imine |
|---|---|
| PubChem CID | 129175719 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (5E,9E)-N,5,9-trimethylundeca-5,9-dien-2-imine |
| SMILES | C/C=C(\C)CC/C=C(\C)CC/C(C)=N/C |
| InChI | InChI=1S/C14H25N/c1-6-12(2)8-7-9-13(3)10-11-14(4)15-5/h6,9H,7-8,10-11H2,1-5H3/b12-6+,13-9+,15-14+ |
| InChIKey | FVVHEFIXSNPQEU-MNASQAFTSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|