C14H26N2 — CID 145317446
(1E,5E)-9-ethylimino-2,6-dimethyldeca-1,5-dien-1-amine (PubChem CID 145317446) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (1E,5E)-9-ethylimino-2,6-dimethyldeca-1,5-dien-1-amine.
| Compound Name | (1E,5E)-9-ethylimino-2,6-dimethyldeca-1,5-dien-1-amine |
|---|---|
| PubChem CID | 145317446 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (1E,5E)-9-ethylimino-2,6-dimethyldeca-1,5-dien-1-amine |
| SMILES | CC/N=C(\C)CC/C(C)=C/CC/C(C)=C/N |
| InChI | InChI=1S/C14H26N2/c1-5-16-14(4)10-9-12(2)7-6-8-13(3)11-15/h7,11H,5-6,8-10,15H2,1-4H3/b12-7+,13-11+,16-14+ |
| InChIKey | GWMXGPAAOVLVDI-ORYVRFJJSA-N |
| XLogP | 3.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|