C12H22 — CID 173346067
3,7-dimethyldeca-2,7-diene (PubChem CID 173346067) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 3,7-dimethyldeca-2,7-diene.
| Compound Name | 3,7-dimethyldeca-2,7-diene |
|---|---|
| PubChem CID | 173346067 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 3,7-dimethyldeca-2,7-diene |
| SMILES | CC=C(C)CCCC(C)=CCC |
| InChI | InChI=1S/C12H22/c1-5-8-12(4)10-7-9-11(3)6-2/h6,8H,5,7,9-10H2,1-4H3 |
| InChIKey | VPJYOZJGQQOUDP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|