About 3-methylhept-2-ene
3-methylhept-2-ene (PubChem CID 91513604) has the molecular formula C8H15+
and a molecular weight of 111.21 g/mol. Its IUPAC name is 3-methylhept-2-ene.
Molecular Properties
| Compound Name | 3-methylhept-2-ene |
| PubChem CID | 91513604 |
| Molecular Formula | C8H15+ |
| Molecular Weight | 111.21 g/mol |
| Exact Mass | 111.12 |
| IUPAC Name | 3-methylhept-2-ene |
| SMILES | [CH2+]CCCC(C)=CC |
| InChI | InChI=1S/C8H15/c1-4-6-7-8(3)5-2/h5H,1,4,6-7H2,2-3H3/q+1 |
| InChIKey | SCEGKZHIOLBTNU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhept-2-ene?
The IUPAC name of 3-methylhept-2-ene (CID 91513604) is 3-methylhept-2-ene.
What is the SMILES notation for 3-methylhept-2-ene?
The canonical SMILES for 3-methylhept-2-ene is [CH2+]CCCC(C)=CC.
What is the InChIKey of 3-methylhept-2-ene?
The InChIKey is SCEGKZHIOLBTNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15/c1-4-6-7-8(3)5-2/h5H,1,4,6-7H2,2-3H3/q+1.
What are the key properties of 3-methylhept-2-ene?
3-methylhept-2-ene has a molecular weight of 111.21 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhept-2-ene is sourced from PubChem (CID 91513604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).