About 11-methyltrideca-1,11-diene
11-methyltrideca-1,11-diene (PubChem CID 139774754) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is 11-methyltrideca-1,11-diene.
Molecular Properties
| Compound Name | 11-methyltrideca-1,11-diene |
| PubChem CID | 139774754 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 11-methyltrideca-1,11-diene |
| SMILES | C=CCCCCCCCCC(C)=CC |
| InChI | InChI=1S/C14H26/c1-4-6-7-8-9-10-11-12-13-14(3)5-2/h4-5H,1,6-13H2,2-3H3 |
| InChIKey | WDUQOJGZPOSVFP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-methyltrideca-1,11-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyltrideca-1,11-diene?
The IUPAC name of 11-methyltrideca-1,11-diene (CID 139774754) is 11-methyltrideca-1,11-diene.
What is the SMILES notation for 11-methyltrideca-1,11-diene?
The canonical SMILES for 11-methyltrideca-1,11-diene is C=CCCCCCCCCC(C)=CC.
What is the InChIKey of 11-methyltrideca-1,11-diene?
The InChIKey is WDUQOJGZPOSVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26/c1-4-6-7-8-9-10-11-12-13-14(3)5-2/h4-5H,1,6-13H2,2-3H3.
What are the key properties of 11-methyltrideca-1,11-diene?
11-methyltrideca-1,11-diene has a molecular weight of 194.36 g/mol, XLogP of 5.26, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyltrideca-1,11-diene is sourced from PubChem (CID 139774754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).