C11H22 — CID 155705867
ethane;(5Z)-5-methylocta-1,5-diene (PubChem CID 155705867) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is ethane;(5Z)-5-methylocta-1,5-diene.
| Compound Name | ethane;(5Z)-5-methylocta-1,5-diene |
|---|---|
| PubChem CID | 155705867 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | ethane;(5Z)-5-methylocta-1,5-diene |
| SMILES | C=CCC/C(C)=C\CC.CC |
| InChI | InChI=1S/C9H16.C2H6/c1-4-6-8-9(3)7-5-2;1-2/h4,7H,1,5-6,8H2,2-3H3;1-2H3/b9-7-; |
| InChIKey | ZWHLREHYHINNKI-VILQZVERSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|