C10H18Cl2Zn — CID 174338717
dichlorozinc;(6E)-2,6-dimethylocta-2,6-diene (PubChem CID 174338717) has the molecular formula C10H18Cl2Zn and a molecular weight of 274.55 g/mol. Its IUPAC name is dichlorozinc;(6E)-2,6-dimethylocta-2,6-diene.
| Compound Name | dichlorozinc;(6E)-2,6-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 174338717 |
| Molecular Formula | C10H18Cl2Zn |
| Molecular Weight | 274.55 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | dichlorozinc;(6E)-2,6-dimethylocta-2,6-diene |
| SMILES | C/C=C(\C)CCC=C(C)C.Cl[Zn]Cl |
| InChI | InChI=1S/C10H18.2ClH.Zn/c1-5-10(4)8-6-7-9(2)3;;;/h5,7H,6,8H2,1-4H3;2*1H;/q;;;+2/p-2/b10-5+;;; |
| InChIKey | IUYBJIOJYDDGOF-RWWJYAHQSA-L |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|