C9H16O — CID 12944525
(1E)-2,6-dimethylhepta-1,5-dien-1-ol (PubChem CID 12944525) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (1E)-2,6-dimethylhepta-1,5-dien-1-ol.
| Compound Name | (1E)-2,6-dimethylhepta-1,5-dien-1-ol |
|---|---|
| PubChem CID | 12944525 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (1E)-2,6-dimethylhepta-1,5-dien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/O |
| InChI | InChI=1S/C9H16O/c1-8(2)5-4-6-9(3)7-10/h5,7,10H,4,6H2,1-3H3/b9-7+ |
| InChIKey | BNWWJOLOPASZSC-VQHVLOKHSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|