C10H18 — CID 175725290
1-deuterio-3,7-dimethylocta-2,6-diene (PubChem CID 175725290) has the molecular formula C10H18 and a molecular weight of 139.26 g/mol. Its IUPAC name is 1-deuterio-3,7-dimethylocta-2,6-diene.
| Compound Name | 1-deuterio-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 175725290 |
| Molecular Formula | C10H18 |
| Molecular Weight | 139.26 g/mol |
| Exact Mass | 139.15 |
| IUPAC Name | 1-deuterio-3,7-dimethylocta-2,6-diene |
| SMILES | [2H]CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C10H18/c1-5-10(4)8-6-7-9(2)3/h5,7H,6,8H2,1-4H3/i1D |
| InChIKey | MZPDTOMKQCMETI-MICDWDOJSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|