C25H42 — CID 101024695
(6E,9R)-2,6,14-trimethyl-10-methylidene-9-[(3R)-3-methylpent-4-enyl]pentadeca-2,6,13-triene (PubChem CID 101024695) has the molecular formula C25H42 and a molecular weight of 342.61 g/mol. Its IUPAC name is (6E,9R)-2,6,14-trimethyl-10-methylidene-9-[(3R)-3-methylpent-4-enyl]pentadeca-2,6,13-triene.
| Compound Name | (6E,9R)-2,6,14-trimethyl-10-methylidene-9-[(3R)-3-methylpent-4-enyl]pentadeca-2,6,13-triene |
|---|---|
| PubChem CID | 101024695 |
| Molecular Formula | C25H42 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | (6E,9R)-2,6,14-trimethyl-10-methylidene-9-[(3R)-3-methylpent-4-enyl]pentadeca-2,6,13-triene |
| SMILES | C=C[C@H](C)CC[C@H](C/C=C(\C)CCC=C(C)C)C(=C)CCC=C(C)C |
| InChI | InChI=1S/C25H42/c1-9-22(6)16-18-25(24(8)15-11-13-21(4)5)19-17-23(7)14-10-12-20(2)3/h9,12-13,17,22,25H,1,8,10-11,14-16,18-19H2,2-7H3/b23-17+/t22-,25+/m0/s1 |
| InChIKey | VLXSQAFKTICBAS-VURWIQAASA-N |
| XLogP | 8.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|