C25H46 — CID 5471130
(E)-2,6,14-trimethyl-10-methylidene-9-(3-methylpent-4-enyl)pentadec-6-ene (PubChem CID 5471130) has the molecular formula C25H46 and a molecular weight of 346.64 g/mol. Its IUPAC name is (E)-2,6,14-trimethyl-10-methylidene-9-(3-methylpent-4-enyl)pentadec-6-ene.
| Compound Name | (E)-2,6,14-trimethyl-10-methylidene-9-(3-methylpent-4-enyl)pentadec-6-ene |
|---|---|
| PubChem CID | 5471130 |
| Molecular Formula | C25H46 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 346.36 |
| IUPAC Name | (E)-2,6,14-trimethyl-10-methylidene-9-(3-methylpent-4-enyl)pentadec-6-ene |
| SMILES | C=CC(C)CCC(C/C=C(\C)CCCC(C)C)C(=C)CCCC(C)C |
| InChI | InChI=1S/C25H46/c1-9-22(6)16-18-25(24(8)15-11-13-21(4)5)19-17-23(7)14-10-12-20(2)3/h9,17,20-22,25H,1,8,10-16,18-19H2,2-7H3/b23-17+ |
| InChIKey | BSXYLMVBPPIDSG-HAVVHWLPSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|