C11H24 — CID 142076338
3,6-dimethylhept-1-ene;ethane (PubChem CID 142076338) has the molecular formula C11H24 and a molecular weight of 156.31 g/mol. Its IUPAC name is 3,6-dimethylhept-1-ene;ethane.
| Compound Name | 3,6-dimethylhept-1-ene;ethane |
|---|---|
| PubChem CID | 142076338 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | 3,6-dimethylhept-1-ene;ethane |
| SMILES | C=CC(C)CCC(C)C.CC |
| InChI | InChI=1S/C9H18.C2H6/c1-5-9(4)7-6-8(2)3;1-2/h5,8-9H,1,6-7H2,2-4H3;1-2H3 |
| InChIKey | XPFCMVZCUDHAHL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|