C9H18 — CID 18443713
3,6-dimethylhept-1-ene (PubChem CID 18443713) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is 3,6-dimethylhept-1-ene.
| Compound Name | 3,6-dimethylhept-1-ene |
|---|---|
| PubChem CID | 18443713 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | 3,6-dimethylhept-1-ene |
| SMILES | C=CC(C)CCC(C)C |
| InChI | InChI=1S/C9H18/c1-5-9(4)7-6-8(2)3/h5,8-9H,1,6-7H2,2-4H3 |
| InChIKey | GNOHGCMWAHDGAT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|