C40H78O — CID 637211
(E,2R,9R,13R)-5,9,13,17-tetramethyl-2-[(6S,10S)-6,10,14-trimethylpentadec-1-en-2-yl]octadec-4-en-1-ol (PubChem CID 637211) has the molecular formula C40H78O and a molecular weight of 575.06 g/mol. Its IUPAC name is (E,2R,9R,13R)-5,9,13,17-tetramethyl-2-[(6S,10S)-6,10,14-trimethylpentadec-1-en-2-yl]octadec-4-en-1-ol.
| Compound Name | (E,2R,9R,13R)-5,9,13,17-tetramethyl-2-[(6S,10S)-6,10,14-trimethylpentadec-1-en-2-yl]octadec-4-en-1-ol |
|---|---|
| PubChem CID | 637211 |
| Molecular Formula | C40H78O |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.61 |
| IUPAC Name | (E,2R,9R,13R)-5,9,13,17-tetramethyl-2-[(6S,10S)-6,10,14-trimethylpentadec-1-en-2-yl]octadec-4-en-1-ol |
| SMILES | C=C(CCC[C@@H](C)CCC[C@@H](C)CCCC(C)C)[C@H](CO)C/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C40H78O/c1-32(2)17-11-19-34(5)21-13-23-36(7)25-15-26-38(9)29-30-40(31-41)39(10)28-16-27-37(8)24-14-22-35(6)20-12-18-33(3)4/h29,32-37,40-41H,10-28,30-31H2,1-9H3/b38-29+/t34-,35+,36-,37+,40+/m1/s1 |
| InChIKey | GAIFBEYPAFEXOA-KLQHPKOWSA-N |
| XLogP | 13.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|