C20H39Br — CID 12905048
(E,7R,11R)-1-bromo-3,7,11,15-tetramethylhexadec-2-ene (PubChem CID 12905048) has the molecular formula C20H39Br and a molecular weight of 359.44 g/mol. Its IUPAC name is (E,7R,11R)-1-bromo-3,7,11,15-tetramethylhexadec-2-ene.
| Compound Name | (E,7R,11R)-1-bromo-3,7,11,15-tetramethylhexadec-2-ene |
|---|---|
| PubChem CID | 12905048 |
| Molecular Formula | C20H39Br |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (E,7R,11R)-1-bromo-3,7,11,15-tetramethylhexadec-2-ene |
| SMILES | C/C(=C\CBr)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H39Br/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
| InChIKey | KQYUEKLNYFZILD-PYDDKJGSSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|