C20H40O — CID 10638184
(E)-3,7,11,15-tetramethyl(2,5,6,9,10,13,14-13C7)hexadec-2-en-1-ol (PubChem CID 10638184) has the molecular formula C20H40O and a molecular weight of 303.49 g/mol. Its IUPAC name is (E)-3,7,11,15-tetramethyl(2,5,6,9,10,13,14-13C7)hexadec-2-en-1-ol.
| Compound Name | (E)-3,7,11,15-tetramethyl(2,5,6,9,10,13,14-13C7)hexadec-2-en-1-ol |
|---|---|
| PubChem CID | 10638184 |
| Molecular Formula | C20H40O |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.33 |
| IUPAC Name | (E)-3,7,11,15-tetramethyl(2,5,6,9,10,13,14-13C7)hexadec-2-en-1-ol |
| SMILES | C/C(C[13CH2][13CH2]C(C)C[13CH2][13CH2]C(C)C[13CH2][13CH2]C(C)C)=[13CH]\CO |
| InChI | InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/i6+1,7+1,8+1,9+1,11+1,13+1,15+1 |
| InChIKey | BOTWFXYSPFMFNR-YPENBOPISA-N |
| XLogP | 6.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|