C19H38S — CID 25254401
(E)-2,6,10,14-tetramethylpentadec-1-ene-1-thiol (PubChem CID 25254401) has the molecular formula C19H38S and a molecular weight of 298.58 g/mol. Its IUPAC name is (E)-2,6,10,14-tetramethylpentadec-1-ene-1-thiol.
| Compound Name | (E)-2,6,10,14-tetramethylpentadec-1-ene-1-thiol |
|---|---|
| PubChem CID | 25254401 |
| Molecular Formula | C19H38S |
| Molecular Weight | 298.58 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | (E)-2,6,10,14-tetramethylpentadec-1-ene-1-thiol |
| SMILES | C/C(=C\S)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C19H38S/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20/h15-18,20H,6-14H2,1-5H3/b19-15+ |
| InChIKey | GOKHUHQHBHFJSV-XDJHFCHBSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.58 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|