C20H41NO — CID 174240836
(E,7R,11R)-1-amino-3,7,11,15-tetramethylhexadec-2-en-1-ol (PubChem CID 174240836) has the molecular formula C20H41NO and a molecular weight of 311.55 g/mol. Its IUPAC name is (E,7R,11R)-1-amino-3,7,11,15-tetramethylhexadec-2-en-1-ol.
| Compound Name | (E,7R,11R)-1-amino-3,7,11,15-tetramethylhexadec-2-en-1-ol |
|---|---|
| PubChem CID | 174240836 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | (E,7R,11R)-1-amino-3,7,11,15-tetramethylhexadec-2-en-1-ol |
| SMILES | C/C(=C\C(N)O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H41NO/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h15-18,20,22H,6-14,21H2,1-5H3/b19-15+/t17-,18-,20?/m1/s1 |
| InChIKey | JCHFNGCDUOWHBI-WFGLNJCISA-N |
| XLogP | 5.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|