C23H46Y-2 — CID 59410843
propane;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-ene;yttrium (PubChem CID 59410843) has the molecular formula C23H46Y-2 and a molecular weight of 411.53 g/mol. Its IUPAC name is propane;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-ene;yttrium.
| Compound Name | propane;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-ene;yttrium |
|---|---|
| PubChem CID | 59410843 |
| Molecular Formula | C23H46Y-2 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | propane;(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-ene;yttrium |
| SMILES | C[CH-]C.[CH2-]/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C.[Y] |
| InChI | InChI=1S/C20H39.C3H7.Y/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3;1-3-2;/h7,17,19-20H,1,8-16H2,2-6H3;3H,1-2H3;/q2*-1;/b18-7+;;/t19-,20+;;/m1../s1 |
| InChIKey | QNESSWWYZFLKMX-DJJDKZSRSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|