About (E)-2,6,10-trimethylundec-1-ene-1-thiol
(E)-2,6,10-trimethylundec-1-ene-1-thiol (PubChem CID 25254254) has the molecular formula C14H28S
and a molecular weight of 228.44 g/mol. Its IUPAC name is (E)-2,6,10-trimethylundec-1-ene-1-thiol.
Molecular Properties
| Compound Name | (E)-2,6,10-trimethylundec-1-ene-1-thiol |
| PubChem CID | 25254254 |
| Molecular Formula | C14H28S |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (E)-2,6,10-trimethylundec-1-ene-1-thiol |
| SMILES | C/C(=C\S)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C14H28S/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15/h11-13,15H,5-10H2,1-4H3/b14-11+ |
| InChIKey | LHYPKSOHYKNKTQ-SDNWHVSQSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,6,10-trimethylundec-1-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,6,10-trimethylundec-1-ene-1-thiol?
The IUPAC name of (E)-2,6,10-trimethylundec-1-ene-1-thiol (CID 25254254) is (E)-2,6,10-trimethylundec-1-ene-1-thiol.
What is the SMILES notation for (E)-2,6,10-trimethylundec-1-ene-1-thiol?
The canonical SMILES for (E)-2,6,10-trimethylundec-1-ene-1-thiol is C/C(=C\S)CCCC(C)CCCC(C)C.
What is the InChIKey of (E)-2,6,10-trimethylundec-1-ene-1-thiol?
The InChIKey is LHYPKSOHYKNKTQ-SDNWHVSQSA-N. The full InChI is InChI=1S/C14H28S/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15/h11-13,15H,5-10H2,1-4H3/b14-11+.
What are the key properties of (E)-2,6,10-trimethylundec-1-ene-1-thiol?
(E)-2,6,10-trimethylundec-1-ene-1-thiol has a molecular weight of 228.44 g/mol, XLogP of 5.45, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,6,10-trimethylundec-1-ene-1-thiol is sourced from PubChem (CID 25254254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).