C14H28S — CID 25254254
(E)-2,6,10-trimethylundec-1-ene-1-thiol (PubChem CID 25254254) has the molecular formula C14H28S and a molecular weight of 228.44 g/mol. Its IUPAC name is (E)-2,6,10-trimethylundec-1-ene-1-thiol.
| Compound Name | (E)-2,6,10-trimethylundec-1-ene-1-thiol |
|---|---|
| PubChem CID | 25254254 |
| Molecular Formula | C14H28S |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (E)-2,6,10-trimethylundec-1-ene-1-thiol |
| SMILES | C/C(=C\S)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C14H28S/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15/h11-13,15H,5-10H2,1-4H3/b14-11+ |
| InChIKey | LHYPKSOHYKNKTQ-SDNWHVSQSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|