C11H21Cl — CID 83163373
1-chloro-4,8-dimethylnon-3-ene (PubChem CID 83163373) has the molecular formula C11H21Cl and a molecular weight of 188.74 g/mol. Its IUPAC name is 1-chloro-4,8-dimethylnon-3-ene.
| Compound Name | 1-chloro-4,8-dimethylnon-3-ene |
|---|---|
| PubChem CID | 83163373 |
| Molecular Formula | C11H21Cl |
| Molecular Weight | 188.74 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-chloro-4,8-dimethylnon-3-ene |
| SMILES | CC(=CCCCl)CCCC(C)C |
| InChI | InChI=1S/C11H21Cl/c1-10(2)6-4-7-11(3)8-5-9-12/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | VYDXFIYLACOLET-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.74 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|