C15H30O2 — CID 23352870
(E)-2,2-dimethoxy-6,10-dimethylundec-5-ene (PubChem CID 23352870) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is (E)-2,2-dimethoxy-6,10-dimethylundec-5-ene.
| Compound Name | (E)-2,2-dimethoxy-6,10-dimethylundec-5-ene |
|---|---|
| PubChem CID | 23352870 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | (E)-2,2-dimethoxy-6,10-dimethylundec-5-ene |
| SMILES | COC(C)(CC/C=C(\C)CCCC(C)C)OC |
| InChI | InChI=1S/C15H30O2/c1-13(2)9-7-10-14(3)11-8-12-15(4,16-5)17-6/h11,13H,7-10,12H2,1-6H3/b14-11+ |
| InChIKey | OADXFGREZMDGOJ-SDNWHVSQSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|