C17H28F6O2 — CID 140695976
(E)-6,10-dimethyl-2,2-bis(2,2,2-trifluoroethoxy)undec-5-ene (PubChem CID 140695976) has the molecular formula C17H28F6O2 and a molecular weight of 378.40 g/mol. Its IUPAC name is (E)-6,10-dimethyl-2,2-bis(2,2,2-trifluoroethoxy)undec-5-ene.
| Compound Name | (E)-6,10-dimethyl-2,2-bis(2,2,2-trifluoroethoxy)undec-5-ene |
|---|---|
| PubChem CID | 140695976 |
| Molecular Formula | C17H28F6O2 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (E)-6,10-dimethyl-2,2-bis(2,2,2-trifluoroethoxy)undec-5-ene |
| SMILES | C/C(=C\CCC(C)(OCC(F)(F)F)OCC(F)(F)F)CCCC(C)C |
| InChI | InChI=1S/C17H28F6O2/c1-13(2)7-5-8-14(3)9-6-10-15(4,24-11-16(18,19)20)25-12-17(21,22)23/h9,13H,5-8,10-12H2,1-4H3/b14-9+ |
| InChIKey | CQTNEUQSGKLZQC-NTEUORMPSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|