C18H32F6O2 — CID 144649241
6,6,10-trimethyl-2,2-bis(2,2,2-trifluoroethoxy)undecane (PubChem CID 144649241) has the molecular formula C18H32F6O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 6,6,10-trimethyl-2,2-bis(2,2,2-trifluoroethoxy)undecane.
| Compound Name | 6,6,10-trimethyl-2,2-bis(2,2,2-trifluoroethoxy)undecane |
|---|---|
| PubChem CID | 144649241 |
| Molecular Formula | C18H32F6O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 6,6,10-trimethyl-2,2-bis(2,2,2-trifluoroethoxy)undecane |
| SMILES | CC(C)CCCC(C)(C)CCCC(C)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C18H32F6O2/c1-14(2)8-6-9-15(3,4)10-7-11-16(5,25-12-17(19,20)21)26-13-18(22,23)24/h14H,6-13H2,1-5H3 |
| InChIKey | LWBXODJCCKCVIH-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|