C22H41F3O2 — CID 162292188
2-ethoxy-6,10,14-trimethyl-2-(2,2,2-trifluoroethoxy)pentadec-5-ene (PubChem CID 162292188) has the molecular formula C22H41F3O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-ethoxy-6,10,14-trimethyl-2-(2,2,2-trifluoroethoxy)pentadec-5-ene.
| Compound Name | 2-ethoxy-6,10,14-trimethyl-2-(2,2,2-trifluoroethoxy)pentadec-5-ene |
|---|---|
| PubChem CID | 162292188 |
| Molecular Formula | C22H41F3O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 2-ethoxy-6,10,14-trimethyl-2-(2,2,2-trifluoroethoxy)pentadec-5-ene |
| SMILES | CCOC(C)(CCC=C(C)CCCC(C)CCCC(C)C)OCC(F)(F)F |
| InChI | InChI=1S/C22H41F3O2/c1-7-26-21(6,27-17-22(23,24)25)16-10-15-20(5)14-9-13-19(4)12-8-11-18(2)3/h15,18-19H,7-14,16-17H2,1-6H3 |
| InChIKey | DOEOSJNQQBOTTC-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|