C22H36F6O2 — CID 140695963
6,10,14-trimethyl-2,2-bis(2,2,2-trifluoroethoxy)pentadeca-5,9-diene (PubChem CID 140695963) has the molecular formula C22H36F6O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 6,10,14-trimethyl-2,2-bis(2,2,2-trifluoroethoxy)pentadeca-5,9-diene.
| Compound Name | 6,10,14-trimethyl-2,2-bis(2,2,2-trifluoroethoxy)pentadeca-5,9-diene |
|---|---|
| PubChem CID | 140695963 |
| Molecular Formula | C22H36F6O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 6,10,14-trimethyl-2,2-bis(2,2,2-trifluoroethoxy)pentadeca-5,9-diene |
| SMILES | CC(=CCCC(C)(OCC(F)(F)F)OCC(F)(F)F)CCC=C(C)CCCC(C)C |
| InChI | InChI=1S/C22H36F6O2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5,29-15-21(23,24)25)30-16-22(26,27)28/h11,13,17H,6-10,12,14-16H2,1-5H3 |
| InChIKey | MQROPOHGGZQKRF-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|