C13H25NO4 — CID 163709313
[(E)-2-hydroperoxy-6,10-dimethylundec-5-en-2-yl] nitrite (PubChem CID 163709313) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is [(E)-2-hydroperoxy-6,10-dimethylundec-5-en-2-yl] nitrite.
| Compound Name | [(E)-2-hydroperoxy-6,10-dimethylundec-5-en-2-yl] nitrite |
|---|---|
| PubChem CID | 163709313 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | [(E)-2-hydroperoxy-6,10-dimethylundec-5-en-2-yl] nitrite |
| SMILES | C/C(=C\CCC(C)(OO)ON=O)CCCC(C)C |
| InChI | InChI=1S/C13H25NO4/c1-11(2)7-5-8-12(3)9-6-10-13(4,18-16)17-14-15/h9,11,16H,5-8,10H2,1-4H3/b12-9+ |
| InChIKey | KHUDALHXZIYZSR-FMIVXFBMSA-N |
| XLogP | 4.44 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|