C18H36O — CID 129151559
(E)-2,6,10-trimethylpentadec-9-en-6-ol (PubChem CID 129151559) has the molecular formula C18H36O and a molecular weight of 268.48 g/mol. Its IUPAC name is (E)-2,6,10-trimethylpentadec-9-en-6-ol.
| Compound Name | (E)-2,6,10-trimethylpentadec-9-en-6-ol |
|---|---|
| PubChem CID | 129151559 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | (E)-2,6,10-trimethylpentadec-9-en-6-ol |
| SMILES | CCCCC/C(C)=C/CCC(C)(O)CCCC(C)C |
| InChI | InChI=1S/C18H36O/c1-6-7-8-12-17(4)13-10-15-18(5,19)14-9-11-16(2)3/h13,16,19H,6-12,14-15H2,1-5H3/b17-13+ |
| InChIKey | DMHHHXGTANBAEE-GHRIWEEISA-N |
| XLogP | 5.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|