C22H44O2 — CID 150121386
2,2-diethoxy-6,10,14-trimethylpentadec-5-ene (PubChem CID 150121386) has the molecular formula C22H44O2 and a molecular weight of 340.59 g/mol. Its IUPAC name is 2,2-diethoxy-6,10,14-trimethylpentadec-5-ene.
| Compound Name | 2,2-diethoxy-6,10,14-trimethylpentadec-5-ene |
|---|---|
| PubChem CID | 150121386 |
| Molecular Formula | C22H44O2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | 2,2-diethoxy-6,10,14-trimethylpentadec-5-ene |
| SMILES | CCOC(C)(CCC=C(C)CCCC(C)CCCC(C)C)OCC |
| InChI | InChI=1S/C22H44O2/c1-8-23-22(7,24-9-2)18-12-17-21(6)16-11-15-20(5)14-10-13-19(3)4/h17,19-20H,8-16,18H2,1-7H3 |
| InChIKey | DZICMTNWNXPBNI-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|