C30H56O2 — CID 140780753
2,6,10-trimethyl-14,14-bis(4-methylpentoxy)pentadeca-2,6,10-triene (PubChem CID 140780753) has the molecular formula C30H56O2 and a molecular weight of 448.78 g/mol. Its IUPAC name is 2,6,10-trimethyl-14,14-bis(4-methylpentoxy)pentadeca-2,6,10-triene.
| Compound Name | 2,6,10-trimethyl-14,14-bis(4-methylpentoxy)pentadeca-2,6,10-triene |
|---|---|
| PubChem CID | 140780753 |
| Molecular Formula | C30H56O2 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.43 |
| IUPAC Name | 2,6,10-trimethyl-14,14-bis(4-methylpentoxy)pentadeca-2,6,10-triene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)(OCCCC(C)C)OCCCC(C)C |
| InChI | InChI=1S/C30H56O2/c1-25(2)15-10-18-28(7)19-11-20-29(8)21-12-22-30(9,31-23-13-16-26(3)4)32-24-14-17-27(5)6/h15,19,21,26-27H,10-14,16-18,20,22-24H2,1-9H3 |
| InChIKey | XXCJRCAEKFQTSB-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|