C26H48O2 — CID 90239470
(6E,10E)-2,6,10-trimethyl-14,14-bis(2-methylpropoxy)pentadeca-2,6,10-triene (PubChem CID 90239470) has the molecular formula C26H48O2 and a molecular weight of 392.67 g/mol. Its IUPAC name is (6E,10E)-2,6,10-trimethyl-14,14-bis(2-methylpropoxy)pentadeca-2,6,10-triene.
| Compound Name | (6E,10E)-2,6,10-trimethyl-14,14-bis(2-methylpropoxy)pentadeca-2,6,10-triene |
|---|---|
| PubChem CID | 90239470 |
| Molecular Formula | C26H48O2 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.37 |
| IUPAC Name | (6E,10E)-2,6,10-trimethyl-14,14-bis(2-methylpropoxy)pentadeca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C26H48O2/c1-21(2)13-10-14-24(7)15-11-16-25(8)17-12-18-26(9,27-19-22(3)4)28-20-23(5)6/h13,15,17,22-23H,10-12,14,16,18-20H2,1-9H3/b24-15+,25-17+ |
| InChIKey | DFAWPSKOOHFDCX-WXCFVEPLSA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|