C15H28 — CID 59164889
(6E)-2,6,10,10-tetramethylundeca-2,6-diene (PubChem CID 59164889) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (6E)-2,6,10,10-tetramethylundeca-2,6-diene.
| Compound Name | (6E)-2,6,10,10-tetramethylundeca-2,6-diene |
|---|---|
| PubChem CID | 59164889 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (6E)-2,6,10,10-tetramethylundeca-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)(C)C |
| InChI | InChI=1S/C15H28/c1-13(2)9-7-10-14(3)11-8-12-15(4,5)6/h9,11H,7-8,10,12H2,1-6H3/b14-11+ |
| InChIKey | GMESWMJLWFKLMA-SDNWHVSQSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|