C15H24O — CID 165353227
(6E)-3,7,11-trimethyl(1,2-13C2)dodeca-6,10-dien-1-yn-3-ol (PubChem CID 165353227) has the molecular formula C15H24O and a molecular weight of 222.34 g/mol. Its IUPAC name is (6E)-3,7,11-trimethyl(1,2-13C2)dodeca-6,10-dien-1-yn-3-ol.
| Compound Name | (6E)-3,7,11-trimethyl(1,2-13C2)dodeca-6,10-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 165353227 |
| Molecular Formula | C15H24O |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | (6E)-3,7,11-trimethyl(1,2-13C2)dodeca-6,10-dien-1-yn-3-ol |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)(O)[13C]#[13CH] |
| InChI | InChI=1S/C15H24O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h1,9,11,16H,7-8,10,12H2,2-5H3/b14-11+/i1+1,6+1 |
| InChIKey | ZNVPGYAGXVEAFP-HTLITPLRSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|