C21H38OSi — CID 101181765
tert-butyl-dimethyl-[(6E)-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-yl]oxysilane (PubChem CID 101181765) has the molecular formula C21H38OSi and a molecular weight of 334.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(6E)-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(6E)-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 101181765 |
| Molecular Formula | C21H38OSi |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | tert-butyl-dimethyl-[(6E)-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-yl]oxysilane |
| SMILES | C#CC(C)(CC/C=C(\C)CCC=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38OSi/c1-11-21(8,22-23(9,10)20(5,6)7)17-13-16-19(4)15-12-14-18(2)3/h1,14,16H,12-13,15,17H2,2-10H3/b19-16+ |
| InChIKey | ZEJWCECJSCSDIK-KNTRCKAVSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|